DNA – The Molecule DNA – The Molecule Deoxyribonucleic Acid.
We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them...
-
Upload
george-mcdaniel -
Category
Documents
-
view
220 -
download
4
Transcript of We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them...
![Page 1: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/1.jpg)
Water
![Page 2: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/2.jpg)
What about molecules?
• We have been studying about elements just by themselves such as oxygen and hydrogen. • If you put them together you have a
molecule of water (H2O).
• A cup of water contains millions of molecules of H2O.
![Page 3: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/3.jpg)
Chemical Formulas
![Page 4: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/4.jpg)
What is a chemical formula?• Chemical, or molecular, formulas are a concise
way of expressing information about the atoms that constitute a particular chemical compound.
• Wait…what?
• It is an expression which states the number and type of atoms present in a molecule of a substance.
![Page 5: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/5.jpg)
Do you know what the chemical formulas are for the following substances?
![Page 6: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/6.jpg)
Carbon dioxide
![Page 7: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/7.jpg)
Sodium chloride or salt
![Page 8: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/8.jpg)
Magnesium sulfate (AKA Epsom salt)
MgSO4
![Page 9: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/9.jpg)
For something more complicated….Glucose or sugar
![Page 10: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/10.jpg)
Subscripts
![Page 11: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/11.jpg)
Definition• A subscript is used to represent the number of
each atom being represented. • If only one atom is represented, there is no
subscript.• In the formula for water, what is the subscript?• There is only one atom of Oxygen, so it does not
have a subscript.
H2OH2OH = HydrogenO = Oxygen
![Page 12: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/12.jpg)
Some exceptions exist
• Usually the subscript just multiplies or shows the number of atoms of a single element. If the subscript exists outside of a set of parenthesis then it will multiply the atoms of all of the elements inside the parenthesis.
• How many of each atom are there now?• Answer: Nitrogen-1, Carbon-3, Hydrogen-9
N(CH3)
3
N = NitrogenC = CarbonH = Hydrogen
![Page 13: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/13.jpg)
Here are some molecules…
![Page 14: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/14.jpg)
• In this image the Carbon atom is blue and the Oxygen atom is red.• Write the chemical formula for this
molecule.Answer: CO
This substance is carbon monoxide
![Page 15: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/15.jpg)
• In this image the Carbon atom is black and the Oxygen atoms are red.
• Write the chemical formula for this molecule.
Answer: CO3
This substance is carbonate
![Page 16: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/16.jpg)
• In this image Hydrogen atoms are white and Nitrogen atom is red.
• Write the chemical formula for this molecule.
Answer: NH3
This substance is ammonia
![Page 17: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/17.jpg)
• In this image blue represents Nitrogen atoms, red represents Oxygen atoms, white represents Hydrogen atoms and black represents Carbon atoms.
• Write the chemical formula for this molecule.
Answer: C8H10N4O2
This substance is caffeine
![Page 18: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/18.jpg)
Coefficient
![Page 19: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/19.jpg)
7H2
O
Definition• Coefficients appear on the left side of a chemical
formula.• They are used to multiply all the atoms in a
compound• In the following formula, which is the coefficient?• Earlier we learned that the subscript 2 meant that
there were two Hydrogen atoms. The coefficient 7 means there are 7 times more.
• How many Hydrogen atoms do we have? • How many Oxygen atoms?
7H2
O
![Page 20: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/20.jpg)
Chemical Equations
![Page 21: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/21.jpg)
Chemical Equations• representation of chemical reaction in
equation: a representation, using chemical symbols in a form resembling a mathematical equation, of the process involved in a chemical reaction
• This is an example of a chemical equation. The components on the left combine together to yield (represented by the arrow) the component on the right.
2H2+O22H2O
![Page 22: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/22.jpg)
Parts to a chemical equation
![Page 23: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/23.jpg)
•2H2+O22H2O
Reactant Produ
ct
Yields
![Page 24: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/24.jpg)
Law of conservation of mass
![Page 25: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/25.jpg)
• Atoms are neither created, nor destroyed, during any chemical reaction.
• This means that the same number of atoms that are present after a reaction are the same number of atoms that are present before a reaction.
• There is only a rearrangement
![Page 26: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/26.jpg)
Balancing chemical equations
![Page 27: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/27.jpg)
Subscripts are never changed when balancing an equation
![Page 28: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/28.jpg)
Step 1• Write out your “un-balanced” equation using
formulas of reactants and products.
CH4+O2CO2+H2O
![Page 29: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/29.jpg)
Step 2• Count up the atoms in the products and reactants.• How many carbons, hydrogens, and oxygens are
on each side? Are they equal?
CH4+O2CO2+H2O
C=1H=4O=2
C=1H=2O=3
They are NOT equal
![Page 30: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/30.jpg)
Step 3• Since our carbons are ok we will not mess with
those now.• However, we have half the number of hydrogens
in the products than we do in the reactants.• What do we need to add? Where do we add it?
CH4+O2CO2+H2OCH4+O2CO2+2H2
O C=1H=4O=2
C=1H=4O=4
They are still NOT equal
![Page 31: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/31.jpg)
Step 4• Now we have half the number of Oxygens.• What do we need to add? Where do we need to
add it? Is everything equal now?
CH4+O2CO2+2H2OCH4+2O2CO2+2H2
O C=1H=4O=4
C=1H=4O=4
They ARE now balanced
![Page 32: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/32.jpg)
Practice Time
![Page 33: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/33.jpg)
H2+O2H2O2H2+O22H2O
![Page 34: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/34.jpg)
Fe+Cl2FeCl32Fe+3Cl22FeCl3
![Page 35: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/35.jpg)
Cu+AgNO3Cu(NO3)2+AgCu+2AgNO3Cu(NO3)2+2Ag
![Page 36: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/36.jpg)
Zn+HClZnCl2+H2
Zn+2HClZnCl2+H2
![Page 37: We have been studying about elements just by themselves such as oxygen and hydrogen. If you put them together you have a molecule of water (H 2 O). A.](https://reader036.fdocuments.in/reader036/viewer/2022062423/56649e7b5503460f94b7d294/html5/thumbnails/37.jpg)
Pb(NO3)2+AlCl3PbCl2+Al(NO3)3
3Pb(NO3)2+2AlCl33PbCl2+2Al(NO3)3