Recognize that chemical formulas are used to identify substances and determine the number of atoms...
-
date post
19-Dec-2015 -
Category
Documents
-
view
215 -
download
0
Transcript of Recognize that chemical formulas are used to identify substances and determine the number of atoms...
Chemical Formulas
TEKS 8.5 D and 8.5 F• Recognize that chemical formulas are used to
identify substances and determine the number of atoms of each element in chemical formulas containing subscripts.
• Recognize whether a chemical equation containing coefficients is balanced or not and how that relates to the law of conservation of mass.
• Recognize the importance of formulas and equations in representing chemical reactions– 1998 TEKS 8.9C
What do you know about chemical reactions, chemical formulas, and chemical equations?
• Teacher can type answers in here.
Chemical Formulas
What is a chemical formula?• Chemical, or molecular, formulas are a concise
way of expressing information about the atoms that constitute a particular chemical compound.
• Wait…what?
• It is an expression which states the number and type of atoms present in a molecule of a substance.
Do you know what the chemical formulas are for the following substances?
Water
Carbon dioxide
Sodium chloride or salt
Magnesium sulfate (AKA Epsom salt)
MgSO4
For something more complicated….Glucose or sugar
Subscripts
Definition• A subscript is used to represent the number of
each atom being represented. • They are only used when more than one atom is
being represented. If only one atom is represented, there is no subscript.
• In the formula for water, what is the subscript?• There is only one atom of Oxygen, so it does not
have a subscript.
H2OH2OH = HydrogenO = Oxygen
Some exceptions exist
• Usually the subscript just multiplies or shows the number of atoms of a single element. If the subscript exists outside of a set of parenthesis then it will multiply the atoms of all of the elements inside the parenthesis.
• How many of each atom are there now?• Answer: Nitrogen-1, Carbon-3, Hydrogen-9
N(CH3)
3
N = NitrogenC = CarbonH = Hydrogen
Here are some molecules…
• In this image Hydrogen atoms are white and Nitrogen atom is red.
• Write the chemical formula for this molecule.
Answer: NH3
This substance is ammonia
• In this image the Carbon atom is black and the Oxygen atoms are red.
• Write the chemical formula for this molecule.
Answer: CO3
This substance is carbonate
• In this image blue represents Nitrogen atoms, red represents Oxygen atoms, white represents Hydrogen atoms and black represents Carbon atoms.
• Write the chemical formula for this molecule.
Answer: C8H10N4O2
This substance is caffeine
• In this image the Carbon atom is blue and the Oxygen atom is red.• Write the chemical formula for this
molecule.Answer: CO
This substance is carbon monoxide
• A harder one:In this image Nitrogen atoms are blue, the Platinum atom is grey, Chlorine atoms are green, and Hydrogen atoms are white.
• Write the chemical formula for this molecule.
Answer: N2PtH6Cl2
Coefficient
7H2
O
Definition• Coefficients appear on the left side of a chemical
formula.• They are used to multiply all the atoms in a
compound• In the following formula, which is the coefficient?• Earlier we learned that the subscript 2 meant that
there were two Hydrogen atoms. The coefficient 7 means there are 7 times more.
• How many Hydrogen atoms do we have? • How many Oxygen atoms?
7H2
O
Chemical Equations
Chemical Equations• representation of chemical reaction in
equation: a representation, using chemical symbols in a form resembling a mathematical equation, of the process involved in a chemical reaction
• This is an example of a chemical equation. The components on the left combine together to yield (represented by the arrow) the component on the right.
2H2+O22H2O
Yields
Definition• The quantity of a specified product obtained in a
reaction or series of reactions, usually expressed as a percentage of the quantity that is theoretically obtainable
Product
Definition• What is produced. • Which side represents the products?
• They are found on the right side of a chemical equation.
2H2+O22H2O2H2+O22H2O
Reactant
Definition• The starting substances.• Which side represents the reactants?
• They are found on the left side of a chemical equation.
2H2+O22H2O2H2+O22H2O
Law of conservation of mass
• Atoms are neither created, nor destroyed, during any chemical reaction.
• This means that the same number of atoms that are present after a reaction are the same number of atoms that are present before a reaction.
• There is only a rearrangement
Balancing chemical equations
Subscripts are never changed when balancing an equation
Step 1• Write out your “un-balanced” equation using
formulas of reactants and products.
CH4+O2CO2+H2O
Step 2• Count up the atoms in the products and reactants.• How many carbons, hydrogens, and oxygens are
on each side? Are they equal?
CH4+O2CO2+H2O
C=1H=4O=2
C=1H=2O=3
They are NOT equal
Step 3• Since our carbons are ok we will not mess with
those now.• However, we have half the number of hydrogens
in the products than we do in the reactants.• What do we need to add? Where do we add it?
CH4+O2CO2+H2OCH4+O2CO2+2H2
O C=1H=4O=2
C=1H=4O=4
They are still NOT equal
Step 4• Now we have half the number of Oxygens.• What do we need to add? Where do we need to
add it? Is everything equal now?
CH4+O2CO2+2H2OCH4+2O2CO2+2H2
O C=1H=4O=4
C=1H=4O=4
They ARE now balanced
Practice Time
H2+O2H2O2H2+O22H2O
Fe+Cl2FeCl32Fe+3Cl22FeCl3
Cu+AgNO3Cu(NO3)2+AgCu+2AgNO3Cu(NO3)2+2Ag
Zn+HClZnCl2+H2
Zn+2HClZnCl2+H2
Pb(NO3)2+AlCl3PbCl2+Al(NO3)3
3Pb(NO3)2+2AlCl33PbCl2+2Al(NO3)3