Post on 15-Jan-2016
C h a p t e r 13C h a p t e r 13
Chemical EquilibriumChemical Equilibrium
The Equilibrium StateThe Equilibrium State
Chemical Equilibrium: The state reached when the concentrations of reactants and products remain constant over time.
2NO2(g)N2O4(g)
BrownColorless
Chemical equilibrium is achieved when:
• the rates of the forward and reverse reactions are equal and
• the concentrations of the reactants and products remain constant
Physical equilibrium
H2O (l)
Chemical equilibrium
N2O4 (g)
H2O (g)
2NO2 (g)colorless brown
N2O4 (g) 2NO2 (g)
Start with NO2 Start with N2O4 Start with NO2 & N2O4
equilibrium
equilibrium
equilibrium
Demo
constant
N2O4 (g) 2NO2 (g)
Using Equilibrium Constants 01Using Equilibrium Constants 01
• We can make the following generalizations concerning the composition of equilibrium mixtures:
If Kc > 103, products predominate over reactants. If Kc is very
large, the reaction is said to proceed to completion.
If Kc is in the range 10–3 to 103, appreciable concentrations
of both reactants and products are present.
If Kc < 10–3, reactants predominate over products. If Kc is
very small, the reaction proceeds hardly at all.
Using the Equilibrium ConstantUsing the Equilibrium Constant
Kc = 4.2 x 10-48
2H2(g) + O2(g)2H2O(g)
(at 500 K)
Kc = 2.4 x 1047
2H2O(g)2H2(g) + O2(g)
(at 500 K)
Kc = 57.0
2HI(g)H2(g) + I2(g)
(at 500 K)
N2O4 (g) 2NO2 (g)
= 4.63 x 10-3K = [NO2]2
[N2O4]
aA + bB cC + dD
K = [C]c[D]d
[A]a[B]bLaw of Mass Action
N2O4 (g) 2NO2 (g)
= 4.63 x 10-3K = [NO2]2
[N2O4]
2NO2 (g) N2O4 (g)
K = [N2O4]
[NO2]2‘ =
1K
= 216
When the equation for a reversible reaction is written in the opposite direction, the equilibrium constant becomes the reciprocal of the original equilibrium constant.
Kc =
Write the Equilibrium Constant KcWrite the Equilibrium Constant Kc
If you multiply both side of an equilibrium reaction by n the equilibrium constant should be raised to the power of n.
N2(g) + 3H2(g)2NH3(g)[NH3]2
[N2][H2]3
=
4NH3(g)2N2(g) + 6H2(g)[N2]2[H2]6
[NH3]4
= Kc´´
1
Kc
2NH3(g)N2(g) + 3H2(g)[N2][H2]3
[NH3]2
Kc =
´
Kc =2
Homogenous equilibrium applies to reactions in which all reacting species are in the same phase.
N2O4 (g) 2NO2 (g)
Kc = [NO2]2
[N2O4]Kp =
NO2P2
N2O4P
In most cases
Kc Kp
aA (g) + bB (g) cC (g) + dD (g)
Kp = Kc(RT)n
n = moles of gaseous products – moles of gaseous reactants
= (c + d) – (a + b)
Homogeneous Equilibrium
CH3COOH (aq) + H2O (l) CH3COO- (aq) + H3O+ (aq)
Kc =‘[CH3COO-][H3O+][CH3COOH][H2O]
[H2O] = constant
Kc = [CH3COO-][H3O+]
[CH3COOH]= Kc [H2O]‘
General practice not to include units for the equilibrium constant.
The concentration of pure liquids are not included in the expression for the equilibrium constant.
The equilibrium concentrations for the reaction between carbon monoxide and molecular chlorine to form COCl2 (g) at 740C are [CO] = 0.012 M, [Cl2] = 0.054 M, and [COCl2] = 0.14 M. Calculate the equilibrium constants Kc and Kp.
CO (g) + Cl2 (g) COCl2 (g)
Kc = [COCl2]
[CO][Cl2]=
0.140.012 x 0.054
= 220
Kp = Kc(RT)n
n = 1 – 2 = -1 R = 0.0821 T = 273 + 74 = 347 K
Kp = 220 x (0.0821 x 347)-1 = 7.7
The equilibrium constant Kp for the reaction
is 158 at 1000K. What is the equilibrium pressure of O2 if the PNO = 0.400 atm and PNO = 0.270 atm?2
2NO2 (g) 2NO (g) + O2 (g)
Kp = 2PNO PO
2
PNO2
2
PO2 = Kp
PNO2
2
PNO2
PO2 = 158 x (0.400)2/(0.270)2 = 347 atm
Heterogenous equilibrium applies to reactions in which reactants and products are in different phases.
CaCO3 (s) CaO (s) + CO2 (g)
Kc =‘[CaO][CO2]
[CaCO3][CaCO3] = constant[CaO] = constant
Kc = [CO2] = Kc x‘[CaCO3][CaO]
Kp = PCO2
The concentration of pure solids and pure liquids are not included in the expression for the equilibrium constant.
PCO 2= Kp
CaCO3 (s) CaO (s) + CO2 (g)
PCO 2 does not depend on the amount of CaCO3 or CaO
Consider the following equilibrium at 295 K:
The partial pressure of each gas is 0.265 atm. Calculate Kp and Kc for the reaction?
NH4HS (s) NH3 (g) + H2S (g)
Kp = PNH3 H2SP = 0.265 x 0.265 = 0.0702
Kp = Kc(RT)n
Kc = Kp(RT)-n
n = 2 – 0 = 2 T = 295 K
Kc = 0.0702 x (0.0821 x 295)-2 = 1.20 x 10-4
Writing Equilibrium Constant Expressions
• The concentrations of the reacting species in the liquid phase are expressed in M. In the gaseous phase, the concentrations can be expressed in M or in atm.
• The concentrations of pure solids and pure liquids, do not appear in the equilibrium constant expressions.
• The equilibrium constant is a dimensionless quantity.
• In quoting a value for the equilibrium constant, you must specify the balanced equation and the temperature.
• If a reaction can be expressed as a sum of two or more If a reaction can be expressed as a sum of two or more reactions, the equilibrium constant for the overall reaction is reactions, the equilibrium constant for the overall reaction is given by the given by the product of the equilibrium constants product of the equilibrium constants of the of the individual reactions.individual reactions.
N2O4 (g) 2NO2 (g)
Start with NO2 Start with N2O4 Start with NO2 & N2O4
equilibrium
equilibrium
equilibrium
DemoReview
The reaction quotient (Qc) is calculated by substituting the initial concentrations of the reactants and products into the equilibrium constant (Kc) expression.
IF
• Qc > Kc system proceeds from right to left to reach equilibrium
• Qc = Kc the system is at equilibrium
• Qc < Kc system proceeds from left to right to reach equilibrium
Kc = [NO2]2
[N2O4]Qc =
[NO2]02
[N2O4]0
Use reaction quotient to predict the direction of shift when the volume is halved in the following equilibrium:
N2O4(g) æ 2 NO2(g),
Use reaction quotient to predict the direction of shift when the volume is halved in the following equilibrium:
N2O4(g) æ 2 NO2(g),
• Consider the reaction: N2O4(g) æ 2 NO2(g), taking place in a cylinder with a volume = 1 unit.
[NO2 ] = 2X mol/1 = 2X[N2O4 ] = X mol/1 = y-X
K = [NO2]2
[N2O4]
Le Châtelier’s Principle 10Le Châtelier’s Principle 10
• The Volume is then halved, which is equivalent to doubling the pressure.
• Since Q > K, the [product] is too high and the reaction progresses in the reverse direction.
At 12800C the equilibrium constant (Kc) for the reaction
Is 1.1 x 10-3. If the initial concentrations are [Br2] = 0.063 M and [Br] = 0.012 M, calculate the concentrations of these species at equilibrium.
Br2 (g) 2Br (g)
Br2 (g) 2Br (g)
Let (x) be the change in concentration of Br2
Initial (M)
Change (M)
Equilibrium (M)
0.063 0.012
-x +2x
0.063 - x 0.012 + 2x
[Br]2
[Br2]Kc = Kc =
(0.012 + 2x)2
0.063 - x= 1.1 x 10-3 Solve for x
Kc = (0.012 + 2x)2
0.063 - x= 1.1 x 10-3
4x2 + 0.048x + 0.000144 = 0.0000693 – 0.0011x
4x2 + 0.0491x + 0.0000747 = 0
ax2 + bx + c =0-b ± b2 – 4ac
2ax =
Br2 (g) 2Br (g)
Initial (M)
Change (M)
Equilibrium (M)
0.063 0.012
-x +2x
0.063 - x 0.012 + 2x
x = -0.00178x = -0.0105
At equilibrium, [Br] = 0.012 + 2x = -0.009 M or 0.00844 M
At equilibrium, [Br2] = 0.063 – x = 0.0648 M
Calculating Equilibrium Concentrations
1. Express the equilibrium concentrations of all species in terms of the initial concentrations and a single unknown x, which represents the change in concentration.
2. Write the equilibrium constant expression in terms of the equilibrium concentrations. Knowing the value of the equilibrium constant, solve for x.
3. Having solved for x, calculate the equilibrium concentrations of all species.
Predicting the direction of a ReactionPredicting the direction of a Reaction
• The reaction quotient (Qc) is obtained by substituting initial concentrations into the equilibrium constant. Predicts reaction direction.
Qc > Kc System proceeds to form reactants.
Qc = Kc System is at equilibrium.
Qc < Kc System proceeds to form products.
Le Châtelier’s Principle 01Le Châtelier’s Principle 01
• Le Châtelier’s principle:
If an external stress
is applied to a system
at equilibrium, the
system adjusts in
such a way that the
stress is partially
offset.
Le Châtelier’s Principle 02Le Châtelier’s Principle 02
• Concentration Changes:
The concentration stress of an added reactant or
product is relieved by reaction in the direction
that consumes the added substance.
The concentration stress of a removed reactant or
product is relieved by reaction in the direction
that replenishes the removed substance.
Le Châtelier’s Principle: Haber process Le Châtelier’s Principle: Haber process
N2(g) + 3 H2(g) æ 2 NH3(g) Exothermic
Cat: iron or ruthenium
Le Châtelier’s Principle 06Le Châtelier’s Principle 06
• The reaction of iron(III) oxide with carbon monoxide occurs in a blast furnace when iron ore is reduced to iron metal:
Fe2O3(s) + 3 CO(g) æ 2 Fe(l) + 3 CO2(g)
• Use Le Châtelier’s principle to predict the direction of reaction when an equilibrium mixture is disturbed by:
•(a) Adding Fe2O3 (b) Removing CO2 (c) Removing CO
Le Châtelier’s Principle 07Le Châtelier’s Principle 07
• Volume and Pressure Changes: Only reactions containing gases are affected by changes in volume and pressure.
Increasing pressure = Decreasing volume
• PV = nRT tells us that increasing pressure or decreasing volume increases concentration.
Le Châtelier’s Principle 08Le Châtelier’s Principle 08
• N2(g) + 3 H2(g) æ 2 NH3(g) Kc = 0.291 at 700
K
Le Châtelier’s Principle 11Le Châtelier’s Principle 11
• Does the number of moles of reaction products increase, decrease, or remain the same when each of the following equilibria is subjected to a decrease in pressure by increasing the volume.
1. PCl5(g) æ PCl3(g) + Cl2(g)
2. CaO(s) + CO2(g) æ CaCO3(s)
3. 3 Fe(s) + 4 H2O(g) æ Fe3O4(s) + 4 H2(g)
• Temperature Changes: Changes in temperature can change the equilibrium constant.
• Endothermic processes
are favored when
temperature increases.
• Exothermic processes
are favored when
temperature decreases.
Le Châtelier’s Principle 13Le Châtelier’s Principle 13
Le Châtelier’s Principle 14Le Châtelier’s Principle 14
• Example:• The reaction N2(g) + 3 H2(g) æ 2 NH3(g) which is exothermic by 92.2 kJ.
Le Châtelier’s Principle 15Le Châtelier’s Principle 15
• In the first step of the Ostwald process for
synthesis of nitric acid, ammonia is oxidized to
nitric oxide by the reaction:
4 NH3(g) + 5 O2(g) æ 4 NO(g) + 6 H2O(g) ∆H° = –905.6 kJ
• How does the equilibrium amount vary with an
increase in temperature?
Le Châtelier’s Principle 16Le Châtelier’s Principle 16
• The following pictures represent the composition of
the equilibrium mixture at 400 K and 500 K for the
reaction A(g) + B(g) æ AB(g).
• Is the reaction
endothermic or
exothermic?
Effect of Catalysis, Reduction of Activation Energy Effect of Catalysis, Reduction of Activation Energy : No effect